C16H30N2 — CID 23552376
5,6-ditert-butyl-1-propyl-2,7-dihydro-1,4-diazepine (PubChem CID 23552376) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 5,6-ditert-butyl-1-propyl-2,7-dihydro-1,4-diazepine.
| Compound Name | 5,6-ditert-butyl-1-propyl-2,7-dihydro-1,4-diazepine |
|---|---|
| PubChem CID | 23552376 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 5,6-ditert-butyl-1-propyl-2,7-dihydro-1,4-diazepine |
| SMILES | CCCN1CC=NC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H30N2/c1-8-10-18-11-9-17-14(16(5,6)7)13(12-18)15(2,3)4/h9H,8,10-12H2,1-7H3 |
| InChIKey | KYNQOEXTXOCLMU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |