C22H17F7N6O2 — CID 145046992
1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-methylphenyl)methyl]-5-(1,3-oxazol-2-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol (PubChem CID 145046992) has the molecular formula C22H17F7N6O2 and a molecular weight of 530.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-methylphenyl)methyl]-5-(1,3-oxazol-2-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-methylphenyl)methyl]-5-(1,3-oxazol-2-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol |
|---|---|
| PubChem CID | 145046992 |
| Molecular Formula | C22H17F7N6O2 |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-methylphenyl)methyl]-5-(1,3-oxazol-2-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol |
| SMILES | Cc1ccccc1Cn1nc(-c2ncc(F)c(NCC(O)(C(F)(F)F)C(F)(F)F)n2)cc1-c1ncco1 |
| InChI | InChI=1S/C22H17F7N6O2/c1-12-4-2-3-5-13(12)10-35-16(19-30-6-7-37-19)8-15(34-35)18-31-9-14(23)17(33-18)32-11-20(36,21(24,25)26)22(27,28)29/h2-9,36H,10-11H2,1H3,(H,31,32,33) |
| InChIKey | QRJBFGGTDMJOIH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |