C26H37NO2 — CID 145047282
(3R)-4-(2-ethyl-5-methoxyphenyl)-1,2,3-trimethyl-4-(2-phenylmethoxyethyl)piperidine (PubChem CID 145047282) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is (3R)-4-(2-ethyl-5-methoxyphenyl)-1,2,3-trimethyl-4-(2-phenylmethoxyethyl)piperidine.
| Compound Name | (3R)-4-(2-ethyl-5-methoxyphenyl)-1,2,3-trimethyl-4-(2-phenylmethoxyethyl)piperidine |
|---|---|
| PubChem CID | 145047282 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | (3R)-4-(2-ethyl-5-methoxyphenyl)-1,2,3-trimethyl-4-(2-phenylmethoxyethyl)piperidine |
| SMILES | CCc1ccc(OC)cc1C1(CCOCc2ccccc2)CCN(C)C(C)[C@@H]1C |
| InChI | InChI=1S/C26H37NO2/c1-6-23-12-13-24(28-5)18-25(23)26(14-16-27(4)21(3)20(26)2)15-17-29-19-22-10-8-7-9-11-22/h7-13,18,20-21H,6,14-17,19H2,1-5H3/t20-,21?,26?/m0/s1 |
| InChIKey | FEXQWLIMMZANEH-XHHNVCIESA-N |
| XLogP | 5.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|