C25H46IN4O4P — CID 145047885
tert-butyl N-[2-[[1-iodophosphanyl-3-[3-(2-methoxyethoxymethyl)-4,4-dimethylcyclohexyl]pyrazol-4-yl]methyl-methylamino]ethyl]-N-methylcarbamate (PubChem CID 145047885) has the molecular formula C25H46IN4O4P and a molecular weight of 624.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-iodophosphanyl-3-[3-(2-methoxyethoxymethyl)-4,4-dimethylcyclohexyl]pyrazol-4-yl]methyl-methylamino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[1-iodophosphanyl-3-[3-(2-methoxyethoxymethyl)-4,4-dimethylcyclohexyl]pyrazol-4-yl]methyl-methylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 145047885 |
| Molecular Formula | C25H46IN4O4P |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | tert-butyl N-[2-[[1-iodophosphanyl-3-[3-(2-methoxyethoxymethyl)-4,4-dimethylcyclohexyl]pyrazol-4-yl]methyl-methylamino]ethyl]-N-methylcarbamate |
| SMILES | COCCOCC1CC(c2nn(PI)cc2CN(C)CCN(C)C(=O)OC(C)(C)C)CCC1(C)C |
| InChI | InChI=1S/C25H46IN4O4P/c1-24(2,3)34-23(31)29(7)12-11-28(6)16-20-17-30(35-26)27-22(20)19-9-10-25(4,5)21(15-19)18-33-14-13-32-8/h17,19,21,35H,9-16,18H2,1-8H3 |
| InChIKey | UWOKCSNXZPCRSM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|