C33H21F2NO5S — CID 145049944
[6-oxo-2-(9-phenylcarbazol-3-yl)benzo[c]chromen-8-yl] 1,1-difluoroethanesulfonate (PubChem CID 145049944) has the molecular formula C33H21F2NO5S and a molecular weight of 581.60 g/mol. Its IUPAC name is [6-oxo-2-(9-phenylcarbazol-3-yl)benzo[c]chromen-8-yl] 1,1-difluoroethanesulfonate.
| Compound Name | [6-oxo-2-(9-phenylcarbazol-3-yl)benzo[c]chromen-8-yl] 1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 145049944 |
| Molecular Formula | C33H21F2NO5S |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | [6-oxo-2-(9-phenylcarbazol-3-yl)benzo[c]chromen-8-yl] 1,1-difluoroethanesulfonate |
| SMILES | CC(F)(F)S(=O)(=O)Oc1ccc2c(c1)c(=O)oc1ccc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)cc12 |
| InChI | InChI=1S/C33H21F2NO5S/c1-33(34,35)42(38,39)41-23-13-14-24-27-18-21(12-16-31(27)40-32(37)28(24)19-23)20-11-15-30-26(17-20)25-9-5-6-10-29(25)36(30)22-7-3-2-4-8-22/h2-19H,1H3 |
| InChIKey | XSEVNCMZQYBHHK-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|