C17H30O2S2 — CID 145050953
2,4-dimethylpentan-2-yl 5-(3-ethenyldithiolan-3-yl)pentanoate (PubChem CID 145050953) has the molecular formula C17H30O2S2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 2,4-dimethylpentan-2-yl 5-(3-ethenyldithiolan-3-yl)pentanoate.
| Compound Name | 2,4-dimethylpentan-2-yl 5-(3-ethenyldithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 145050953 |
| Molecular Formula | C17H30O2S2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2,4-dimethylpentan-2-yl 5-(3-ethenyldithiolan-3-yl)pentanoate |
| SMILES | C=CC1(CCCCC(=O)OC(C)(C)CC(C)C)CCSS1 |
| InChI | InChI=1S/C17H30O2S2/c1-6-17(11-12-20-21-17)10-8-7-9-15(18)19-16(4,5)13-14(2)3/h6,14H,1,7-13H2,2-5H3 |
| InChIKey | VFCIRTCSPFYGKJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|