C17H18ClN — CID 145051194
4-[(4E,6Z)-4-chloro-2,6-dimethylocta-2,4,6-trien-3-yl]benzonitrile (PubChem CID 145051194) has the molecular formula C17H18ClN and a molecular weight of 271.79 g/mol. Its IUPAC name is 4-[(4E,6Z)-4-chloro-2,6-dimethylocta-2,4,6-trien-3-yl]benzonitrile.
| Compound Name | 4-[(4E,6Z)-4-chloro-2,6-dimethylocta-2,4,6-trien-3-yl]benzonitrile |
|---|---|
| PubChem CID | 145051194 |
| Molecular Formula | C17H18ClN |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-[(4E,6Z)-4-chloro-2,6-dimethylocta-2,4,6-trien-3-yl]benzonitrile |
| SMILES | C/C=C(C)\C=C(\Cl)C(=C(C)C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H18ClN/c1-5-13(4)10-16(18)17(12(2)3)15-8-6-14(11-19)7-9-15/h5-10H,1-4H3/b13-5-,16-10+ |
| InChIKey | BHWWKZNXPFONGU-JPHHCLGMSA-N |
| XLogP | 5.44 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|