C19H23N — CID 144500663
4-[(2Z,4E)-6-propan-2-ylidenenona-2,4-dien-4-yl]benzonitrile (PubChem CID 144500663) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[(2Z,4E)-6-propan-2-ylidenenona-2,4-dien-4-yl]benzonitrile.
| Compound Name | 4-[(2Z,4E)-6-propan-2-ylidenenona-2,4-dien-4-yl]benzonitrile |
|---|---|
| PubChem CID | 144500663 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-[(2Z,4E)-6-propan-2-ylidenenona-2,4-dien-4-yl]benzonitrile |
| SMILES | C/C=C\C(=C/C(CCC)=C(C)C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H23N/c1-5-7-18(15(3)4)13-19(8-6-2)17-11-9-16(14-20)10-12-17/h6,8-13H,5,7H2,1-4H3/b8-6-,19-13+ |
| InChIKey | RHYZSVNTCYVLKW-ZYJHPGJTSA-N |
| XLogP | 5.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|