C15H19F2NSi — CID 71552314
4-(2,2-difluoro-1-triethylsilylethenyl)benzonitrile (PubChem CID 71552314) has the molecular formula C15H19F2NSi and a molecular weight of 279.41 g/mol. Its IUPAC name is 4-(2,2-difluoro-1-triethylsilylethenyl)benzonitrile.
| Compound Name | 4-(2,2-difluoro-1-triethylsilylethenyl)benzonitrile |
|---|---|
| PubChem CID | 71552314 |
| Molecular Formula | C15H19F2NSi |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-(2,2-difluoro-1-triethylsilylethenyl)benzonitrile |
| SMILES | CC[Si](CC)(CC)C(=C(F)F)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H19F2NSi/c1-4-19(5-2,6-3)14(15(16)17)13-9-7-12(11-18)8-10-13/h7-10H,4-6H2,1-3H3 |
| InChIKey | MRKLMURSCHVOQK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|