C18H24ClN3O3 — CID 145051323
2-[[2-(2-chloroacetyl)imino-4-phenylbutanoyl]amino]-4-methylpentanamide (PubChem CID 145051323) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-[[2-(2-chloroacetyl)imino-4-phenylbutanoyl]amino]-4-methylpentanamide.
| Compound Name | 2-[[2-(2-chloroacetyl)imino-4-phenylbutanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 145051323 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[[2-(2-chloroacetyl)imino-4-phenylbutanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)CC(NC(=O)/C(CCc1ccccc1)=N\C(=O)CCl)C(N)=O |
| InChI | InChI=1S/C18H24ClN3O3/c1-12(2)10-15(17(20)24)22-18(25)14(21-16(23)11-19)9-8-13-6-4-3-5-7-13/h3-7,12,15H,8-11H2,1-2H3,(H2,20,24)(H,22,25)/b21-14- |
| InChIKey | ROBOZQVGXXLIDE-STZFKDTASA-N |
| XLogP | 1.84 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|