C30H30O2 — CID 145051598
9-[(2E,4E)-5-ethenoxyhexa-2,4-dien-2-yl]-9-(4-ethenoxyphenyl)-4-methyl-3,4-dihydrofluorene (PubChem CID 145051598) has the molecular formula C30H30O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 9-[(2E,4E)-5-ethenoxyhexa-2,4-dien-2-yl]-9-(4-ethenoxyphenyl)-4-methyl-3,4-dihydrofluorene.
| Compound Name | 9-[(2E,4E)-5-ethenoxyhexa-2,4-dien-2-yl]-9-(4-ethenoxyphenyl)-4-methyl-3,4-dihydrofluorene |
|---|---|
| PubChem CID | 145051598 |
| Molecular Formula | C30H30O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 9-[(2E,4E)-5-ethenoxyhexa-2,4-dien-2-yl]-9-(4-ethenoxyphenyl)-4-methyl-3,4-dihydrofluorene |
| SMILES | C=CO/C(C)=C/C=C(\C)C1(c2ccc(OC=C)cc2)C2=C(c3ccccc31)C(C)CC=C2 |
| InChI | InChI=1S/C30H30O2/c1-6-31-23(5)16-15-22(4)30(24-17-19-25(20-18-24)32-7-2)27-13-9-8-12-26(27)29-21(3)11-10-14-28(29)30/h6-10,12-21H,1-2,11H2,3-5H3/b22-15+,23-16+ |
| InChIKey | PYIQJFDBBJKVGN-QAOSGDJLSA-N |
| XLogP | 7.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|