C25H32O2 — CID 145054234
4-[(E)-1-cyclobutyl-3-(2-methylphenyl)hept-3-enyl]-2-methoxyphenol (PubChem CID 145054234) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 4-[(E)-1-cyclobutyl-3-(2-methylphenyl)hept-3-enyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-1-cyclobutyl-3-(2-methylphenyl)hept-3-enyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 145054234 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-[(E)-1-cyclobutyl-3-(2-methylphenyl)hept-3-enyl]-2-methoxyphenol |
| SMILES | CCC/C=C(\CC(c1ccc(O)c(OC)c1)C1CCC1)c1ccccc1C |
| InChI | InChI=1S/C25H32O2/c1-4-5-10-20(22-13-7-6-9-18(22)2)16-23(19-11-8-12-19)21-14-15-24(26)25(17-21)27-3/h6-7,9-10,13-15,17,19,23,26H,4-5,8,11-12,16H2,1-3H3/b20-10+ |
| InChIKey | RDBGBYGARKPMIY-KEBDBYFISA-N |
| XLogP | 6.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |