About (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen
(Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen (PubChem CID 171562984) has the molecular formula C31H46O2
and a molecular weight of 450.71 g/mol. Its IUPAC name is (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen.
Molecular Properties
| Compound Name | (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen |
| PubChem CID | 171562984 |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen |
| SMILES | CC1CCCCCC1.CCC/C=C(/CCC(=O)Cc1cccc(OC)c1)c1ccccc1C.[H][H] |
| InChI | InChI=1S/C23H28O2.C8H16.H2/c1-4-5-11-20(23-13-7-6-9-18(23)2)14-15-21(24)16-19-10-8-12-22(17-19)25-3;1-8-6-4-2-3-5-7-8;/h6-13,17H,4-5,14-16H2,1-3H3;8H,2-7H2,1H3;1H/b20-11-;; |
| InChIKey | YRPMLGNPYWDCGO-ARFXNZMASA-N |
| XLogP | 9.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen?
The IUPAC name of (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen (CID 171562984) is (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen.
What is the SMILES notation for (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen?
The canonical SMILES for (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen is CC1CCCCCC1.CCC/C=C(/CCC(=O)Cc1cccc(OC)c1)c1ccccc1C.[H][H].
What is the InChIKey of (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen?
The InChIKey is YRPMLGNPYWDCGO-ARFXNZMASA-N. The full InChI is InChI=1S/C23H28O2.C8H16.H2/c1-4-5-11-20(23-13-7-6-9-18(23)2)14-15-21(24)16-19-10-8-12-22(17-19)25-3;1-8-6-4-2-3-5-7-8;/h6-13,17H,4-5,14-16H2,1-3H3;8H,2-7H2,1H3;1H/b20-11-;;.
What are the key properties of (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen?
(Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen has a molecular weight of 450.71 g/mol, XLogP of 9.00, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(3-methoxyphenyl)-5-(2-methylphenyl)non-5-en-2-one;methylcycloheptane;molecular hydrogen is sourced from PubChem (CID 171562984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).