C33H58N2 — CID 145055784
6,6-diethyl-3,9-dimethylidene-N,N'-bis(5-methylidenehept-6-en-2-yl)undecane-1,11-diamine (PubChem CID 145055784) has the molecular formula C33H58N2 and a molecular weight of 482.84 g/mol. Its IUPAC name is 6,6-diethyl-3,9-dimethylidene-N,N'-bis(5-methylidenehept-6-en-2-yl)undecane-1,11-diamine.
| Compound Name | 6,6-diethyl-3,9-dimethylidene-N,N'-bis(5-methylidenehept-6-en-2-yl)undecane-1,11-diamine |
|---|---|
| PubChem CID | 145055784 |
| Molecular Formula | C33H58N2 |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 482.46 |
| IUPAC Name | 6,6-diethyl-3,9-dimethylidene-N,N'-bis(5-methylidenehept-6-en-2-yl)undecane-1,11-diamine |
| SMILES | C=CC(=C)CCC(C)NCCC(=C)CCC(CC)(CC)CCC(=C)CCNC(C)CCC(=C)C=C |
| InChI | InChI=1S/C33H58N2/c1-11-27(5)15-17-31(9)34-25-21-29(7)19-23-33(13-3,14-4)24-20-30(8)22-26-35-32(10)18-16-28(6)12-2/h11-12,31-32,34-35H,1-2,5-8,13-26H2,3-4,9-10H3 |
| InChIKey | OLVMOKRIPWXHNT-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|