C18H23N5 — CID 145056053
(3Z)-2-[4-(cyclohexylamino)quinazolin-6-yl]buta-1,3-diene-1,4-diamine (PubChem CID 145056053) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is (3Z)-2-[4-(cyclohexylamino)quinazolin-6-yl]buta-1,3-diene-1,4-diamine.
| Compound Name | (3Z)-2-[4-(cyclohexylamino)quinazolin-6-yl]buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145056053 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | (3Z)-2-[4-(cyclohexylamino)quinazolin-6-yl]buta-1,3-diene-1,4-diamine |
| SMILES | NC=C(/C=C\N)c1ccc2ncnc(NC3CCCCC3)c2c1 |
| InChI | InChI=1S/C18H23N5/c19-9-8-14(11-20)13-6-7-17-16(10-13)18(22-12-21-17)23-15-4-2-1-3-5-15/h6-12,15H,1-5,19-20H2,(H,21,22,23)/b9-8-,14-11? |
| InChIKey | LEYQUVJCGXKIRT-LDLFAOIFSA-N |
| XLogP | 3.15 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|