C19H26N6 — CID 147652172
1-N-[6-(1-amino-3-iminoprop-1-enyl)quinazolin-4-yl]-4-N,4-N-dimethylcyclohexane-1,4-diamine (PubChem CID 147652172) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-N-[6-(1-amino-3-iminoprop-1-enyl)quinazolin-4-yl]-4-N,4-N-dimethylcyclohexane-1,4-diamine.
| Compound Name | 1-N-[6-(1-amino-3-iminoprop-1-enyl)quinazolin-4-yl]-4-N,4-N-dimethylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 147652172 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-N-[6-(1-amino-3-iminoprop-1-enyl)quinazolin-4-yl]-4-N,4-N-dimethylcyclohexane-1,4-diamine |
| SMILES | [H]/N=C/C=C(N)c1ccc2ncnc(NC3CCC(N(C)C)CC3)c2c1 |
| InChI | InChI=1S/C19H26N6/c1-25(2)15-6-4-14(5-7-15)24-19-16-11-13(17(21)9-10-20)3-8-18(16)22-12-23-19/h3,8-12,14-15,20H,4-7,21H2,1-2H3,(H,22,23,24)/b17-9?,20-10+ |
| InChIKey | CMKNFBRMNNBHQG-FHUMIKEHSA-N |
| XLogP | 2.86 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|