C27H32F3N5 — CID 145056664
2-[6-[4-[2-(4-propylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide (PubChem CID 145056664) has the molecular formula C27H32F3N5 and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-[6-[4-[2-(4-propylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide.
| Compound Name | 2-[6-[4-[2-(4-propylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 145056664 |
| Molecular Formula | C27H32F3N5 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 2-[6-[4-[2-(4-propylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC1C1=NCC=C(c2ccc(CCc3ccc(CCC)cc3)c(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C27H32F3N5/c1-2-4-18-6-8-19(9-7-18)10-11-20-12-13-21(17-22(20)27(28,29)30)23-14-15-33-25(34-23)24-5-3-16-35(24)26(31)32/h6-9,12-14,17,24H,2-5,10-11,15-16H2,1H3,(H3,31,32)(H,33,34) |
| InChIKey | DIBNDLRTYHVIPV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|