About (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane
(Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane (PubChem CID 145056794) has the molecular formula C12H15BrF3N
and a molecular weight of 310.16 g/mol. Its IUPAC name is (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane.
Molecular Properties
| Compound Name | (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane |
| PubChem CID | 145056794 |
| Molecular Formula | C12H15BrF3N |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane |
| SMILES | C.CC/C=C(\N)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11BrF3N.CH4/c1-2-3-10(16)7-4-5-9(12)8(6-7)11(13,14)15;/h3-6H,2,16H2,1H3;1H4/b10-3-; |
| InChIKey | BWWIRIKDKDQOMU-HVHUWTQGSA-N |
| XLogP | 4.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane?
The IUPAC name of (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane (CID 145056794) is (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane.
What is the SMILES notation for (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane?
The canonical SMILES for (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane is C.CC/C=C(\N)c1ccc(Br)c(C(F)(F)F)c1.
What is the InChIKey of (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane?
The InChIKey is BWWIRIKDKDQOMU-HVHUWTQGSA-N. The full InChI is InChI=1S/C11H11BrF3N.CH4/c1-2-3-10(16)7-4-5-9(12)8(6-7)11(13,14)15;/h3-6H,2,16H2,1H3;1H4/b10-3-;.
What are the key properties of (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane?
(Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane has a molecular weight of 310.16 g/mol, XLogP of 4.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[4-bromo-3-(trifluoromethyl)phenyl]but-1-en-1-amine;methane is sourced from PubChem (CID 145056794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).