C15H23N3O2 — CID 145061573
5-tert-butyl-N-[(Z)-2-methylidenepent-3-enyl]-1,2,4-oxadiazole-3-carboxamide;ethene (PubChem CID 145061573) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-tert-butyl-N-[(Z)-2-methylidenepent-3-enyl]-1,2,4-oxadiazole-3-carboxamide;ethene.
| Compound Name | 5-tert-butyl-N-[(Z)-2-methylidenepent-3-enyl]-1,2,4-oxadiazole-3-carboxamide;ethene |
|---|---|
| PubChem CID | 145061573 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 5-tert-butyl-N-[(Z)-2-methylidenepent-3-enyl]-1,2,4-oxadiazole-3-carboxamide;ethene |
| SMILES | C=C.C=C(/C=C\C)CNC(=O)c1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H19N3O2.C2H4/c1-6-7-9(2)8-14-11(17)10-15-12(18-16-10)13(3,4)5;1-2/h6-7H,2,8H2,1,3-5H3,(H,14,17);1-2H2/b7-6-; |
| InChIKey | RQAXFMSFVFPACM-NAFXZHHSSA-N |
| XLogP | 3.03 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|