C8H15N3O — CID 145062592
(2E)-2-[ethyl(methyl)hydrazinylidene]-N-methylbut-3-enamide (PubChem CID 145062592) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is (2E)-2-[ethyl(methyl)hydrazinylidene]-N-methylbut-3-enamide.
| Compound Name | (2E)-2-[ethyl(methyl)hydrazinylidene]-N-methylbut-3-enamide |
|---|---|
| PubChem CID | 145062592 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (2E)-2-[ethyl(methyl)hydrazinylidene]-N-methylbut-3-enamide |
| SMILES | C=C/C(=N\N(C)CC)C(=O)NC |
| InChI | InChI=1S/C8H15N3O/c1-5-7(8(12)9-3)10-11(4)6-2/h5H,1,6H2,2-4H3,(H,9,12)/b10-7+ |
| InChIKey | JBKHXJCWSPYZRR-JXMROGBWSA-N |
| XLogP | 0.23 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|