C8H12F3N3O — CID 177229975
(2E)-2-(dimethylhydrazinylidene)-N-(2,2,2-trifluoroethyl)but-3-enamide (PubChem CID 177229975) has the molecular formula C8H12F3N3O and a molecular weight of 223.20 g/mol. Its IUPAC name is (2E)-2-(dimethylhydrazinylidene)-N-(2,2,2-trifluoroethyl)but-3-enamide.
| Compound Name | (2E)-2-(dimethylhydrazinylidene)-N-(2,2,2-trifluoroethyl)but-3-enamide |
|---|---|
| PubChem CID | 177229975 |
| Molecular Formula | C8H12F3N3O |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | (2E)-2-(dimethylhydrazinylidene)-N-(2,2,2-trifluoroethyl)but-3-enamide |
| SMILES | C=C/C(=N\N(C)C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O/c1-4-6(13-14(2)3)7(15)12-5-8(9,10)11/h4H,1,5H2,2-3H3,(H,12,15)/b13-6+ |
| InChIKey | SUUYTGOOCVWCPK-AWNIVKPZSA-N |
| XLogP | 0.77 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|