About (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane
(2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane (PubChem CID 177229999) has the molecular formula C11H21F2N3O
and a molecular weight of 249.31 g/mol. Its IUPAC name is (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane.
Molecular Properties
| Compound Name | (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane |
| PubChem CID | 177229999 |
| Molecular Formula | C11H21F2N3O |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane |
| SMILES | C=C/C(=N\N(C)C)C(=O)NCCC(F)F.CC |
| InChI | InChI=1S/C9H15F2N3O.C2H6/c1-4-7(13-14(2)3)9(15)12-6-5-8(10)11;1-2/h4,8H,1,5-6H2,2-3H3,(H,12,15);1-2H3/b13-7+; |
| InChIKey | DFYFMEKNROXVBU-FTPOTTDRSA-N |
| XLogP | 1.89 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane?
The IUPAC name of (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane (CID 177229999) is (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane.
What is the SMILES notation for (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane?
The canonical SMILES for (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane is C=C/C(=N\N(C)C)C(=O)NCCC(F)F.CC.
What is the InChIKey of (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane?
The InChIKey is DFYFMEKNROXVBU-FTPOTTDRSA-N. The full InChI is InChI=1S/C9H15F2N3O.C2H6/c1-4-7(13-14(2)3)9(15)12-6-5-8(10)11;1-2/h4,8H,1,5-6H2,2-3H3,(H,12,15);1-2H3/b13-7+;.
What are the key properties of (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane?
(2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane has a molecular weight of 249.31 g/mol, XLogP of 1.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide;ethane is sourced from PubChem (CID 177229999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).