C11H22N2O — CID 22764760
N-[4-(dimethylamino)hexyl]prop-2-enamide (PubChem CID 22764760) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N-[4-(dimethylamino)hexyl]prop-2-enamide.
| Compound Name | N-[4-(dimethylamino)hexyl]prop-2-enamide |
|---|---|
| PubChem CID | 22764760 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N-[4-(dimethylamino)hexyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCC(CC)N(C)C |
| InChI | InChI=1S/C11H22N2O/c1-5-10(13(3)4)8-7-9-12-11(14)6-2/h6,10H,2,5,7-9H2,1,3-4H3,(H,12,14) |
| InChIKey | GLVRNSAWFKIFON-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|