C9H15F2N3O — CID 177230000
(2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide (PubChem CID 177230000) has the molecular formula C9H15F2N3O and a molecular weight of 219.24 g/mol. Its IUPAC name is (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide.
| Compound Name | (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide |
|---|---|
| PubChem CID | 177230000 |
| Molecular Formula | C9H15F2N3O |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (2E)-N-(3,3-difluoropropyl)-2-(dimethylhydrazinylidene)but-3-enamide |
| SMILES | C=C/C(=N\N(C)C)C(=O)NCCC(F)F |
| InChI | InChI=1S/C9H15F2N3O/c1-4-7(13-14(2)3)9(15)12-6-5-8(10)11/h4,8H,1,5-6H2,2-3H3,(H,12,15)/b13-7+ |
| InChIKey | FNPFXEBBFOPSAI-NTUHNPAUSA-N |
| XLogP | 0.86 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|