C11H14F3N — CID 145063672
2,3,6,7-tetramethyl-4-(trifluoromethyl)-3H-azepine (PubChem CID 145063672) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-4-(trifluoromethyl)-3H-azepine.
| Compound Name | 2,3,6,7-tetramethyl-4-(trifluoromethyl)-3H-azepine |
|---|---|
| PubChem CID | 145063672 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2,3,6,7-tetramethyl-4-(trifluoromethyl)-3H-azepine |
| SMILES | CC1=NC(C)=C(C)C=C(C(F)(F)F)C1C |
| InChI | InChI=1S/C11H14F3N/c1-6-5-10(11(12,13)14)7(2)9(4)15-8(6)3/h5,7H,1-4H3 |
| InChIKey | BZBKRKMHIRYTNP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |