C8H18N4 — CID 145064556
ethane;3-ethenyl-1,2,4-triazol-4-amine (PubChem CID 145064556) has the molecular formula C8H18N4 and a molecular weight of 170.26 g/mol. Its IUPAC name is ethane;3-ethenyl-1,2,4-triazol-4-amine.
| Compound Name | ethane;3-ethenyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 145064556 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | ethane;3-ethenyl-1,2,4-triazol-4-amine |
| SMILES | C=Cc1nncn1N.CC.CC |
| InChI | InChI=1S/C4H6N4.2C2H6/c1-2-4-7-6-3-8(4)5;2*1-2/h2-3H,1,5H2;2*1-2H3 |
| InChIKey | RJPDDKCDBAHOOL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |