C21H23ClN4O — CID 145065974
5-chloro-2-ethyl-N-(4-piperidin-1-ylphenyl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 145065974) has the molecular formula C21H23ClN4O and a molecular weight of 382.90 g/mol. Its IUPAC name is 5-chloro-2-ethyl-N-(4-piperidin-1-ylphenyl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 5-chloro-2-ethyl-N-(4-piperidin-1-ylphenyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145065974 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-chloro-2-ethyl-N-(4-piperidin-1-ylphenyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CCc1nn2ccc(Cl)cc2c1C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H23ClN4O/c1-2-18-20(19-14-15(22)10-13-26(19)24-18)21(27)23-16-6-8-17(9-7-16)25-11-4-3-5-12-25/h6-10,13-14H,2-5,11-12H2,1H3,(H,23,27) |
| InChIKey | LSGDHDDURDBSDB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|