C28H21Br2F4N2P — CID 145072697
N-[(Z)-1-(6,9-dibromo-1,2,3,3-tetrafluoro-2-methyl-1-phosphanyl-11-pyridin-2-ylcyclopenta[l]phenanthren-4-yl)prop-1-enyl]ethanimine (PubChem CID 145072697) has the molecular formula C28H21Br2F4N2P and a molecular weight of 652.26 g/mol. Its IUPAC name is N-[(Z)-1-(6,9-dibromo-1,2,3,3-tetrafluoro-2-methyl-1-phosphanyl-11-pyridin-2-ylcyclopenta[l]phenanthren-4-yl)prop-1-enyl]ethanimine.
| Compound Name | N-[(Z)-1-(6,9-dibromo-1,2,3,3-tetrafluoro-2-methyl-1-phosphanyl-11-pyridin-2-ylcyclopenta[l]phenanthren-4-yl)prop-1-enyl]ethanimine |
|---|---|
| PubChem CID | 145072697 |
| Molecular Formula | C28H21Br2F4N2P |
| Molecular Weight | 652.26 g/mol |
| Exact Mass | 649.97 |
| IUPAC Name | N-[(Z)-1-(6,9-dibromo-1,2,3,3-tetrafluoro-2-methyl-1-phosphanyl-11-pyridin-2-ylcyclopenta[l]phenanthren-4-yl)prop-1-enyl]ethanimine |
| SMILES | C/C=N\C(=C/C)c1cc(Br)cc2c1c1c(c3c(-c4ccccn4)cc(Br)cc32)C(F)(P)C(C)(F)C1(F)F |
| InChI | InChI=1S/C28H21Br2F4N2P/c1-4-20(35-5-2)18-12-14(29)10-16-17-11-15(30)13-19(21-8-6-7-9-36-21)23(17)25-24(22(16)18)27(32,33)26(3,31)28(25,34)37/h4-13H,37H2,1-3H3/b20-4-,35-5- |
| InChIKey | LSESVWFOZLKYIU-PYTGMQHCSA-N |
| XLogP | 9.86 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.26 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|