C13H13N3 — CID 145073828
2-imidazo[1,2-a]pyridin-2-ylcyclohexa-1,3-dien-1-amine (PubChem CID 145073828) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-2-ylcyclohexa-1,3-dien-1-amine.
| Compound Name | 2-imidazo[1,2-a]pyridin-2-ylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145073828 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-2-ylcyclohexa-1,3-dien-1-amine |
| SMILES | NC1=C(c2cn3ccccc3n2)C=CCC1 |
| InChI | InChI=1S/C13H13N3/c14-11-6-2-1-5-10(11)12-9-16-8-4-3-7-13(16)15-12/h1,3-5,7-9H,2,6,14H2 |
| InChIKey | WUTZPLYCSQSRAT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |