About CID 56646935
CID 56646935 (PubChem CID 56646935) has the molecular formula C14H9N4O
and a molecular weight of 249.25 g/mol.
Molecular Properties
| Compound Name | CID 56646935 |
| PubChem CID | 56646935 |
| Molecular Formula | C14H9N4O |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | — |
| SMILES | [O]c1nc2ccccn2c1-c1cn2ccccc2n1 |
| InChI | InChI=1S/C14H9N4O/c19-14-13(18-8-4-2-6-12(18)16-14)10-9-17-7-3-1-5-11(17)15-10/h1-9H |
| InChIKey | GTBSFJMBRWUZIL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 56646935 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56646935?
The IUPAC name of CID 56646935 (CID 56646935) is not available.
What is the SMILES notation for CID 56646935?
The canonical SMILES for CID 56646935 is [O]c1nc2ccccn2c1-c1cn2ccccc2n1.
What is the InChIKey of CID 56646935?
The InChIKey is GTBSFJMBRWUZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N4O/c19-14-13(18-8-4-2-6-12(18)16-14)10-9-17-7-3-1-5-11(17)15-10/h1-9H.
What are the key properties of CID 56646935?
CID 56646935 has a molecular weight of 249.25 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56646935 is sourced from PubChem (CID 56646935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).