C16H36N2O2 — CID 145076946
1,4-dimethylpiperidine;ethane;N-methyl-4-oxobutanamide (PubChem CID 145076946) has the molecular formula C16H36N2O2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;ethane;N-methyl-4-oxobutanamide.
| Compound Name | 1,4-dimethylpiperidine;ethane;N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 145076946 |
| Molecular Formula | C16H36N2O2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 1,4-dimethylpiperidine;ethane;N-methyl-4-oxobutanamide |
| SMILES | CC.CC.CC1CCN(C)CC1.CNC(=O)CCC=O |
| InChI | InChI=1S/C7H15N.C5H9NO2.2C2H6/c1-7-3-5-8(2)6-4-7;1-6-5(8)3-2-4-7;2*1-2/h7H,3-6H2,1-2H3;4H,2-3H2,1H3,(H,6,8);2*1-2H3 |
| InChIKey | DEWBADRINOCGAP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|