C41H37BrN2S — CID 145077478
N-[(1E,3Z,5Z)-6-[7-bromo-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-2-yl]hexa-1,3,5-trienyl]dibenzothiophen-2-amine;(Z)-but-2-ene (PubChem CID 145077478) has the molecular formula C41H37BrN2S and a molecular weight of 669.73 g/mol. Its IUPAC name is N-[(1E,3Z,5Z)-6-[7-bromo-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-2-yl]hexa-1,3,5-trienyl]dibenzothiophen-2-amine;(Z)-but-2-ene.
| Compound Name | N-[(1E,3Z,5Z)-6-[7-bromo-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-2-yl]hexa-1,3,5-trienyl]dibenzothiophen-2-amine;(Z)-but-2-ene |
|---|---|
| PubChem CID | 145077478 |
| Molecular Formula | C41H37BrN2S |
| Molecular Weight | 669.73 g/mol |
| Exact Mass | 668.19 |
| IUPAC Name | N-[(1E,3Z,5Z)-6-[7-bromo-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-2-yl]hexa-1,3,5-trienyl]dibenzothiophen-2-amine;(Z)-but-2-ene |
| SMILES | C/C=C\C.C=C/C=C(\C=C/C)n1c2cc(Br)ccc2c2ccc(/C=C\C=C/C=C/Nc3ccc4sc5ccccc5c4c3)cc21 |
| InChI | InChI=1S/C37H29BrN2S.C4H8/c1-3-11-29(12-4-2)40-34-23-26(16-19-30(34)31-20-17-27(38)24-35(31)40)13-7-5-6-10-22-39-28-18-21-37-33(25-28)32-14-8-9-15-36(32)41-37;1-3-4-2/h3-25,39H,1H2,2H3;3-4H,1-2H3/b6-5-,12-4-,13-7-,22-10+,29-11+;4-3- |
| InChIKey | IHPQYFQVJQMLJZ-MGXBHMTPSA-N |
| XLogP | 13.31 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.73 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|