C22H24ClN3O — CID 145078398
N-(4-chlorophenyl)acetamide;4-cyclohexylquinazoline (PubChem CID 145078398) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)acetamide;4-cyclohexylquinazoline.
| Compound Name | N-(4-chlorophenyl)acetamide;4-cyclohexylquinazoline |
|---|---|
| PubChem CID | 145078398 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-(4-chlorophenyl)acetamide;4-cyclohexylquinazoline |
| SMILES | CC(=O)Nc1ccc(Cl)cc1.c1ccc2c(C3CCCCC3)ncnc2c1 |
| InChI | InChI=1S/C14H16N2.C8H8ClNO/c1-2-6-11(7-3-1)14-12-8-4-5-9-13(12)15-10-16-14;1-6(11)10-8-4-2-7(9)3-5-8/h4-5,8-11H,1-3,6-7H2;2-5H,1H3,(H,10,11) |
| InChIKey | RBVLETKOJOKHOA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |