About ethane;2-(phenylmethoxymethylamino)acetic acid
ethane;2-(phenylmethoxymethylamino)acetic acid (PubChem CID 145078900) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is ethane;2-(phenylmethoxymethylamino)acetic acid.
Molecular Properties
| Compound Name | ethane;2-(phenylmethoxymethylamino)acetic acid |
| PubChem CID | 145078900 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | ethane;2-(phenylmethoxymethylamino)acetic acid |
| SMILES | CC.O=C(O)CNCOCc1ccccc1 |
| InChI | InChI=1S/C10H13NO3.C2H6/c12-10(13)6-11-8-14-7-9-4-2-1-3-5-9;1-2/h1-5,11H,6-8H2,(H,12,13);1-2H3 |
| InChIKey | UZWYLIYRDQUSOZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(phenylmethoxymethylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(phenylmethoxymethylamino)acetic acid?
The IUPAC name of ethane;2-(phenylmethoxymethylamino)acetic acid (CID 145078900) is ethane;2-(phenylmethoxymethylamino)acetic acid.
What is the SMILES notation for ethane;2-(phenylmethoxymethylamino)acetic acid?
The canonical SMILES for ethane;2-(phenylmethoxymethylamino)acetic acid is CC.O=C(O)CNCOCc1ccccc1.
What is the InChIKey of ethane;2-(phenylmethoxymethylamino)acetic acid?
The InChIKey is UZWYLIYRDQUSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3.C2H6/c12-10(13)6-11-8-14-7-9-4-2-1-3-5-9;1-2/h1-5,11H,6-8H2,(H,12,13);1-2H3.
What are the key properties of ethane;2-(phenylmethoxymethylamino)acetic acid?
ethane;2-(phenylmethoxymethylamino)acetic acid has a molecular weight of 225.29 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(phenylmethoxymethylamino)acetic acid is sourced from PubChem (CID 145078900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).