C25H30BrN5O6 — CID 174280501
N-[2-[(4-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[[2-[(2-bromoacetyl)amino]acetyl]amino]acetyl]amino]acetamide (PubChem CID 174280501) has the molecular formula C25H30BrN5O6 and a molecular weight of 576.45 g/mol. Its IUPAC name is N-[2-[(4-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[[2-[(2-bromoacetyl)amino]acetyl]amino]acetyl]amino]acetamide.
| Compound Name | N-[2-[(4-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[[2-[(2-bromoacetyl)amino]acetyl]amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 174280501 |
| Molecular Formula | C25H30BrN5O6 |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | N-[2-[(4-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[[2-[(2-bromoacetyl)amino]acetyl]amino]acetyl]amino]acetamide |
| SMILES | O=C(CBr)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCOCc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H30BrN5O6/c26-11-21(32)27-12-22(33)28-13-23(34)29-14-24(35)30-15-25(36)31-17-37-16-20-8-6-19(7-9-20)10-18-4-2-1-3-5-18/h1-9H,10-17H2,(H,27,32)(H,28,33)(H,29,34)(H,30,35)(H,31,36) |
| InChIKey | GIRSUQWKQGOWHC-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 154.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|