C24H29BrN4O5 — CID 174280690
N-[2-[(3-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[(2-bromoacetyl)amino]acetyl]amino]propanamide (PubChem CID 174280690) has the molecular formula C24H29BrN4O5 and a molecular weight of 533.42 g/mol. Its IUPAC name is N-[2-[(3-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[(2-bromoacetyl)amino]acetyl]amino]propanamide.
| Compound Name | N-[2-[(3-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[(2-bromoacetyl)amino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 174280690 |
| Molecular Formula | C24H29BrN4O5 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | N-[2-[(3-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[(2-bromoacetyl)amino]acetyl]amino]propanamide |
| SMILES | CC(NC(=O)CNC(=O)CBr)C(=O)NCC(=O)NCOCc1cccc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H29BrN4O5/c1-17(29-23(32)14-26-21(30)12-25)24(33)27-13-22(31)28-16-34-15-20-9-5-8-19(11-20)10-18-6-3-2-4-7-18/h2-9,11,17H,10,12-16H2,1H3,(H,26,30)(H,27,33)(H,28,31)(H,29,32) |
| InChIKey | WBGOWOAUBSYWDW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|