C23H27BrN4O5 — CID 174280342
N-[2-[(3-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[(2-bromoacetyl)amino]acetyl]amino]acetamide (PubChem CID 174280342) has the molecular formula C23H27BrN4O5 and a molecular weight of 519.40 g/mol. Its IUPAC name is N-[2-[(3-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[(2-bromoacetyl)amino]acetyl]amino]acetamide.
| Compound Name | N-[2-[(3-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[(2-bromoacetyl)amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 174280342 |
| Molecular Formula | C23H27BrN4O5 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[2-[(3-benzylphenyl)methoxymethylamino]-2-oxoethyl]-2-[[2-[(2-bromoacetyl)amino]acetyl]amino]acetamide |
| SMILES | O=C(CBr)NCC(=O)NCC(=O)NCC(=O)NCOCc1cccc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H27BrN4O5/c24-11-20(29)25-12-21(30)26-13-22(31)27-14-23(32)28-16-33-15-19-8-4-7-18(10-19)9-17-5-2-1-3-6-17/h1-8,10H,9,11-16H2,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | IPLBNVXUJXAEEI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|