C20H28 — CID 145083384
1-tert-butyl-3-[(3Z)-3,5,6-trimethylhepta-1,3,5-trien-2-yl]benzene (PubChem CID 145083384) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-tert-butyl-3-[(3Z)-3,5,6-trimethylhepta-1,3,5-trien-2-yl]benzene.
| Compound Name | 1-tert-butyl-3-[(3Z)-3,5,6-trimethylhepta-1,3,5-trien-2-yl]benzene |
|---|---|
| PubChem CID | 145083384 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-tert-butyl-3-[(3Z)-3,5,6-trimethylhepta-1,3,5-trien-2-yl]benzene |
| SMILES | C=C(/C(C)=C\C(C)=C(C)C)c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H28/c1-14(2)15(3)12-16(4)17(5)18-10-9-11-19(13-18)20(6,7)8/h9-13H,5H2,1-4,6-8H3/b16-12- |
| InChIKey | SRHGOODAJBTYJR-VBKFSLOCSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|