C17H23P — CID 137401537
2-[3-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]phenyl]propan-2-ylphosphane (PubChem CID 137401537) has the molecular formula C17H23P and a molecular weight of 258.35 g/mol. Its IUPAC name is 2-[3-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]phenyl]propan-2-ylphosphane.
| Compound Name | 2-[3-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]phenyl]propan-2-ylphosphane |
|---|---|
| PubChem CID | 137401537 |
| Molecular Formula | C17H23P |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[3-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]phenyl]propan-2-ylphosphane |
| SMILES | C=C(C)/C=C\C=C(/C)c1cccc(C(C)(C)P)c1 |
| InChI | InChI=1S/C17H23P/c1-13(2)8-6-9-14(3)15-10-7-11-16(12-15)17(4,5)18/h6-12H,1,18H2,2-5H3/b8-6-,14-9+ |
| InChIKey | QSNQJRABLWBLCB-CURXYISGSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|