C15H19F2OP — CID 162549136
[[3-[(1E)-1-ethoxy-2,3-dimethylbuta-1,3-dienyl]phenyl]-difluoromethyl]phosphane (PubChem CID 162549136) has the molecular formula C15H19F2OP and a molecular weight of 284.29 g/mol. Its IUPAC name is [[3-[(1E)-1-ethoxy-2,3-dimethylbuta-1,3-dienyl]phenyl]-difluoromethyl]phosphane.
| Compound Name | [[3-[(1E)-1-ethoxy-2,3-dimethylbuta-1,3-dienyl]phenyl]-difluoromethyl]phosphane |
|---|---|
| PubChem CID | 162549136 |
| Molecular Formula | C15H19F2OP |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [[3-[(1E)-1-ethoxy-2,3-dimethylbuta-1,3-dienyl]phenyl]-difluoromethyl]phosphane |
| SMILES | C=C(C)/C(C)=C(/OCC)c1cccc(C(F)(F)P)c1 |
| InChI | InChI=1S/C15H19F2OP/c1-5-18-14(11(4)10(2)3)12-7-6-8-13(9-12)15(16,17)19/h6-9H,2,5,19H2,1,3-4H3/b14-11+ |
| InChIKey | WUTQRZLVABCHRZ-SDNWHVSQSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|