C23H30F2N2 — CID 137401611
(3E,5E)-2-N-cyclopentyl-6-[3-(1,1-difluoroethyl)phenyl]-2-N-prop-1-en-2-ylhepta-1,3,5-triene-2,3-diamine (PubChem CID 137401611) has the molecular formula C23H30F2N2 and a molecular weight of 372.50 g/mol. Its IUPAC name is (3E,5E)-2-N-cyclopentyl-6-[3-(1,1-difluoroethyl)phenyl]-2-N-prop-1-en-2-ylhepta-1,3,5-triene-2,3-diamine.
| Compound Name | (3E,5E)-2-N-cyclopentyl-6-[3-(1,1-difluoroethyl)phenyl]-2-N-prop-1-en-2-ylhepta-1,3,5-triene-2,3-diamine |
|---|---|
| PubChem CID | 137401611 |
| Molecular Formula | C23H30F2N2 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | (3E,5E)-2-N-cyclopentyl-6-[3-(1,1-difluoroethyl)phenyl]-2-N-prop-1-en-2-ylhepta-1,3,5-triene-2,3-diamine |
| SMILES | C=C(C)N(C(=C)/C(N)=C\C=C(/C)c1cccc(C(C)(F)F)c1)C1CCCC1 |
| InChI | InChI=1S/C23H30F2N2/c1-16(2)27(21-11-6-7-12-21)18(4)22(26)14-13-17(3)19-9-8-10-20(15-19)23(5,24)25/h8-10,13-15,21H,1,4,6-7,11-12,26H2,2-3,5H3/b17-13+,22-14+ |
| InChIKey | QPGWQQBHZSWONT-MTPWMXCOSA-N |
| XLogP | 6.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|