C17H18ClF3N4 — CID 145083641
4-chloro-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene;ethane (PubChem CID 145083641) has the molecular formula C17H18ClF3N4 and a molecular weight of 370.81 g/mol. Its IUPAC name is 4-chloro-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene;ethane.
| Compound Name | 4-chloro-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene;ethane |
|---|---|
| PubChem CID | 145083641 |
| Molecular Formula | C17H18ClF3N4 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-chloro-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene;ethane |
| SMILES | CC.FC(F)(F)c1cc(-c2nc3c(cc2Cl)N2CCC(C2)N3)ccn1 |
| InChI | InChI=1S/C15H12ClF3N4.C2H6/c16-10-6-11-14(21-9-2-4-23(11)7-9)22-13(10)8-1-3-20-12(5-8)15(17,18)19;1-2/h1,3,5-6,9H,2,4,7H2,(H,21,22);1-2H3 |
| InChIKey | ZLCKKSDIUMABPW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |