C13H23N3O3 — CID 145084746
ethane;N-[2-(oxolan-3-yloxy)pyrimidin-4-yl]formamide (PubChem CID 145084746) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethane;N-[2-(oxolan-3-yloxy)pyrimidin-4-yl]formamide.
| Compound Name | ethane;N-[2-(oxolan-3-yloxy)pyrimidin-4-yl]formamide |
|---|---|
| PubChem CID | 145084746 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | ethane;N-[2-(oxolan-3-yloxy)pyrimidin-4-yl]formamide |
| SMILES | CC.CC.O=CNc1ccnc(OC2CCOC2)n1 |
| InChI | InChI=1S/C9H11N3O3.2C2H6/c13-6-11-8-1-3-10-9(12-8)15-7-2-4-14-5-7;2*1-2/h1,3,6-7H,2,4-5H2,(H,10,11,12,13);2*1-2H3 |
| InChIKey | VJOHTSUWLZHTPZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|