C17H19F3N4 — CID 145084771
ethane;5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 145084771) has the molecular formula C17H19F3N4 and a molecular weight of 336.36 g/mol. Its IUPAC name is ethane;5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | ethane;5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 145084771 |
| Molecular Formula | C17H19F3N4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | ethane;5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | CC.FC(F)(F)c1cccc(-c2ncc3c(n2)NC2CCN3C2)c1 |
| InChI | InChI=1S/C15H13F3N4.C2H6/c16-15(17,18)10-3-1-2-9(6-10)13-19-7-12-14(21-13)20-11-4-5-22(12)8-11;1-2/h1-3,6-7,11H,4-5,8H2,(H,19,20,21);1-2H3 |
| InChIKey | CZULCAGROYGXKP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |