About (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate
(4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate (PubChem CID 145084883) has the molecular formula C22H20N2O2
and a molecular weight of 344.41 g/mol. Its IUPAC name is (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate |
| PubChem CID | 145084883 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate |
| SMILES | C/C(=C\c1ccc(-c2ccc(N)cc2)cc1)C(=O)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C22H20N2O2/c1-15(22(25)26-21-12-10-20(24)11-13-21)14-16-2-4-17(5-3-16)18-6-8-19(23)9-7-18/h2-14H,23-24H2,1H3/b15-14+ |
| InChIKey | FSWMXZNORVFPGV-CCEZHUSRSA-N |
| XLogP | 4.53 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate?
The IUPAC name of (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate (CID 145084883) is (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate.
What is the SMILES notation for (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate?
The canonical SMILES for (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate is C/C(=C\c1ccc(-c2ccc(N)cc2)cc1)C(=O)Oc1ccc(N)cc1.
What is the InChIKey of (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate?
The InChIKey is FSWMXZNORVFPGV-CCEZHUSRSA-N. The full InChI is InChI=1S/C22H20N2O2/c1-15(22(25)26-21-12-10-20(24)11-13-21)14-16-2-4-17(5-3-16)18-6-8-19(23)9-7-18/h2-14H,23-24H2,1H3/b15-14+.
What are the key properties of (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate?
(4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate has a molecular weight of 344.41 g/mol, XLogP of 4.53, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) (E)-3-[4-(4-aminophenyl)phenyl]-2-methylprop-2-enoate is sourced from PubChem (CID 145084883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).