About methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid
methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid (PubChem CID 158427747) has the molecular formula C21H22N2O6
and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid.
Molecular Properties
| Compound Name | methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid |
| PubChem CID | 158427747 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid |
| SMILES | C/C(=C\c1ccc([N+](=O)[O-])cc1)C(=O)O.COC(=O)/C(C)=C/c1ccc(N)cc1 |
| InChI | InChI=1S/C11H13NO2.C10H9NO4/c1-8(11(13)14-2)7-9-3-5-10(12)6-4-9;1-7(10(12)13)6-8-2-4-9(5-3-8)11(14)15/h3-7H,12H2,1-2H3;2-6H,1H3,(H,12,13)/b8-7+;7-6+ |
| InChIKey | HBGNPRCCHDZQOG-JAIRJOOHSA-N |
| XLogP | 3.93 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid?
The IUPAC name of methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid (CID 158427747) is methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid.
What is the SMILES notation for methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid?
The canonical SMILES for methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid is C/C(=C\c1ccc([N+](=O)[O-])cc1)C(=O)O.COC(=O)/C(C)=C/c1ccc(N)cc1.
What is the InChIKey of methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid?
The InChIKey is HBGNPRCCHDZQOG-JAIRJOOHSA-N. The full InChI is InChI=1S/C11H13NO2.C10H9NO4/c1-8(11(13)14-2)7-9-3-5-10(12)6-4-9;1-7(10(12)13)6-8-2-4-9(5-3-8)11(14)15/h3-7H,12H2,1-2H3;2-6H,1H3,(H,12,13)/b8-7+;7-6+.
What are the key properties of methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid?
methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid has a molecular weight of 398.42 g/mol, XLogP of 3.93, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(4-aminophenyl)-2-methylprop-2-enoate;(E)-2-methyl-3-(4-nitrophenyl)prop-2-enoic acid is sourced from PubChem (CID 158427747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).