About 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane
1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane (PubChem CID 145087578) has the molecular formula C9H19NOS
and a molecular weight of 189.32 g/mol. Its IUPAC name is 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane.
Analyze 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane?
The IUPAC name of 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane (CID 145087578) is 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane.
What is the SMILES notation for 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane?
The canonical SMILES for 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane is CC.CC(=O)C1CSC(C)N1C.
What is the InChIKey of 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane?
The InChIKey is PTOKMIMCVLTZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NOS.C2H6/c1-5(9)7-4-10-6(2)8(7)3;1-2/h6-7H,4H2,1-3H3;1-2H3.
What are the key properties of 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane?
1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane has a molecular weight of 189.32 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethyl-1,3-thiazolidin-4-yl)ethanone;ethane is sourced from PubChem (CID 145087578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).