C29H28N2 — CID 145088499
N-(3,4-dimethylphenyl)naphthalen-2-amine;N-methylnaphthalen-2-amine (PubChem CID 145088499) has the molecular formula C29H28N2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)naphthalen-2-amine;N-methylnaphthalen-2-amine.
| Compound Name | N-(3,4-dimethylphenyl)naphthalen-2-amine;N-methylnaphthalen-2-amine |
|---|---|
| PubChem CID | 145088499 |
| Molecular Formula | C29H28N2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-(3,4-dimethylphenyl)naphthalen-2-amine;N-methylnaphthalen-2-amine |
| SMILES | CNc1ccc2ccccc2c1.Cc1ccc(Nc2ccc3ccccc3c2)cc1C |
| InChI | InChI=1S/C18H17N.C11H11N/c1-13-7-9-17(11-14(13)2)19-18-10-8-15-5-3-4-6-16(15)12-18;1-12-11-7-6-9-4-2-3-5-10(9)8-11/h3-12,19H,1-2H3;2-8,12H,1H3 |
| InChIKey | ZLYFXDNUPAUAHU-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |