C19H17NOS — CID 91605380
O-naphthalen-2-yl N-(3,4-dimethylphenyl)carbamothioate (PubChem CID 91605380) has the molecular formula C19H17NOS and a molecular weight of 307.42 g/mol. Its IUPAC name is O-naphthalen-2-yl N-(3,4-dimethylphenyl)carbamothioate.
| Compound Name | O-naphthalen-2-yl N-(3,4-dimethylphenyl)carbamothioate |
|---|---|
| PubChem CID | 91605380 |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | O-naphthalen-2-yl N-(3,4-dimethylphenyl)carbamothioate |
| SMILES | Cc1ccc(NC(=S)Oc2ccc3ccccc3c2)cc1C |
| InChI | InChI=1S/C19H17NOS/c1-13-7-9-17(11-14(13)2)20-19(22)21-18-10-8-15-5-3-4-6-16(15)12-18/h3-12H,1-2H3,(H,20,22) |
| InChIKey | XHJABWFIKKETCB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|