C28H23Cl2N3O2S2 — CID 145088926
6-chloro-N-[2-[[2-[(5-chloro-4-ethylcyclohepta-1,4,6-triene-1-carbonyl)amino]phenyl]disulfanyl]phenyl]pyridine-3-carboxamide (PubChem CID 145088926) has the molecular formula C28H23Cl2N3O2S2 and a molecular weight of 568.55 g/mol. Its IUPAC name is 6-chloro-N-[2-[[2-[(5-chloro-4-ethylcyclohepta-1,4,6-triene-1-carbonyl)amino]phenyl]disulfanyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-[[2-[(5-chloro-4-ethylcyclohepta-1,4,6-triene-1-carbonyl)amino]phenyl]disulfanyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145088926 |
| Molecular Formula | C28H23Cl2N3O2S2 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | 6-chloro-N-[2-[[2-[(5-chloro-4-ethylcyclohepta-1,4,6-triene-1-carbonyl)amino]phenyl]disulfanyl]phenyl]pyridine-3-carboxamide |
| SMILES | CCC1=C(Cl)C=CC(C(=O)Nc2ccccc2SSc2ccccc2NC(=O)c2ccc(Cl)nc2)=CC1 |
| InChI | InChI=1S/C28H23Cl2N3O2S2/c1-2-18-11-12-19(13-15-21(18)29)27(34)32-22-7-3-5-9-24(22)36-37-25-10-6-4-8-23(25)33-28(35)20-14-16-26(30)31-17-20/h3-10,12-17H,2,11H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | CUXKQGZLMVNGSM-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|